* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | R(+)-THIOAMYLAL SODIUM |
| CAS: | 51165-40-3 |
| English Synonyms: | R(+)-THIOAMYLAL SODIUM |
| MDL Number.: | MFCD01744303 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CCC[C@@H](C)C1(C(=O)NC(=S)N(C1=O)[Na])CC=C |
| InChi: | InChI=1S/C12H18N2O2S.Na/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16;/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17);/q;+1/p-1/t8-;/m1./s1 |
| InChiKey: | InChIKey=LYZGJWXNOGIVQA-DDWIOCJRSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.