* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINOLINE, 4-(2-(1-PYRROLIDINYL)ETHOXY)- |
| CAS: | 32226-69-0 |
| English Synonyms: | QUINOLINE, 4-(2-(1-PYRROLIDINYL)ETHOXY)- |
| MDL Number.: | MFCD01749977 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc2c(c1)c(ccn2)OCCN3CCCC3.Cl |
| InChi: | InChI=1S/C15H18N2O.ClH/c1-2-6-14-13(5-1)15(7-8-16-14)18-12-11-17-9-3-4-10-17;/h1-2,5-8H,3-4,9-12H2;1H |
| InChiKey: | InChIKey=PHYSQWXGRFIQNE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.