* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EMOLECULES 5640365 |
| English Synonyms: | EMOLECULES 5640365 |
| MDL Number.: | MFCD02078928 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)c1cnc2cccc[n+]2c1Cl.[Cl-] |
| InChi: | InChI=1S/C11H10ClN2O2.ClH/c1-2-16-11(15)8-7-13-9-5-3-4-6-14(9)10(8)12;/h3-7H,2H2,1H3;1H/q+1;/p-1 |
| InChiKey: | InChIKey=DGNUZESSERURNG-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.