* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOVALTRATE |
English Synonyms: | ISOVALTRATE |
MDL Number.: | MFCD02094173 |
H bond acceptor: | 8 |
H bond donor: | 0 |
Smile: | CC(C)CC(=O)OCC1=CO[C@H]([C@H]2C1=C[C@@H]([C@]23CO3)OC(=O)C)OC(=O)CC(C)C |
InChi: | InChI=1S/C22H30O8/c1-12(2)6-18(24)26-9-15-10-27-21(30-19(25)7-13(3)4)20-16(15)8-17(29-14(5)23)22(20)11-28-22/h8,10,12-13,17,20-21H,6-7,9,11H2,1-5H3/t17-,20+,21-,22+/m0/s1 |
InChiKey: | InChIKey=XLACUABANMZLCJ-KVJIRVJXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.