* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB020600 |
English Synonyms: | VITAS-BB TBB020600 |
MDL Number.: | MFCD02177207 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCCOC(=O)C1=C(NC(=O)CSC2=CC=CC=C2)SC=C1C1=CC=C(C=C1)C(C)(C)C |
InChi: | InChI=1S/C26H29NO3S2/c1-5-15-30-25(29)23-21(18-11-13-19(14-12-18)26(2,3)4)16-32-24(23)27-22(28)17-31-20-9-7-6-8-10-20/h6-14,16H,5,15,17H2,1-4H3,(H,27,28) |
InChiKey: | InChIKey=SBXKVUNZCARHAW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.