* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WW-781 |
CAS: | 79811-16-8 |
English Synonyms: | WW-781 |
MDL Number.: | MFCD02183505 |
H bond acceptor: | 11 |
H bond donor: | 1 |
Smile: | CCCCN1C(=O)C(=C/C=C/C=C/C2C(=NN(C2=O)c3ccc(cc3)S(=O)(=O)O)C)C(=O)N(C1=O)CCCC |
InChi: | InChI=1S/C27H32N4O7S/c1-4-6-17-29-24(32)23(25(33)30(27(29)35)18-7-5-2)12-10-8-9-11-22-19(3)28-31(26(22)34)20-13-15-21(16-14-20)39(36,37)38/h8-16,22H,4-7,17-18H2,1-3H3,(H,36,37,38)/b10-8+,11-9+ |
InChiKey: | InChIKey=ZSJQWOYTDGVNSG-GFULKKFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.