* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH1334033 |
| English Synonyms: | FCHGROUP FCH1334033 |
| MDL Number.: | MFCD02258214 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1(C(=O)N(S(=O)(=O)N1)CC2CC2)C |
| InChi: | InChI=1S/C8H14N2O3S/c1-8(2)7(11)10(5-6-3-4-6)14(12,13)9-8/h6,9H,3-5H2,1-2H3 |
| InChiKey: | InChIKey=UZBJRKVQFAKNPI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.