* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL 6-KETO-7-OCTENOATE |
| CAS: | 50628-92-7 |
| English Synonyms: | ETHYL 6-KETO-7-OCTENOATE ; ETHYL 6-OXOOCT-7-ENOATE |
| MDL Number.: | MFCD02259809 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCOC(=O)CCCCC(=O)C=C |
| InChi: | InChI=1S/C10H16O3/c1-3-9(11)7-5-6-8-10(12)13-4-2/h3H,1,4-8H2,2H3 |
| InChiKey: | InChIKey=RALHBGNZVSDWEN-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.