* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUININE BENZOATE |
| CAS: | 750-88-9 |
| English Synonyms: | QUININE BENZOATE |
| MDL Number.: | MFCD02683876 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | COc1ccc2c(c1)c(ccn2)[C@@H]([C@@H]3C[C@@H]4CCN3C[C@@H]4C=C)OC(=O)Oc5ccccc5 |
| InChi: | InChI=1S/C27H28N2O4/c1-3-18-17-29-14-12-19(18)15-25(29)26(33-27(30)32-20-7-5-4-6-8-20)22-11-13-28-24-10-9-21(31-2)16-23(22)24/h3-11,13,16,18-19,25-26H,1,12,14-15,17H2,2H3/t18-,19-,25-,26-/m0/s1 |
| InChiKey: | InChIKey=QYPJZCMPIALCAQ-KBFVSZBXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.