* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-L-TRP(5-NH2) |
English Synonyms: | FMOC-L-TRP(5-NH2) |
MDL Number.: | MFCD03094815 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1ccc2c(c1)-c3ccccc3C2COC(=O)N[C@@H](Cc4cc5cc(ccc5[nH]4)N)C(=O)O |
InChi: | InChI=1S/C26H23N3O4/c27-16-9-10-23-15(11-16)12-17(28-23)13-24(25(30)31)29-26(32)33-14-22-20-7-3-1-5-18(20)19-6-2-4-8-21(19)22/h1-12,22,24,28H,13-14,27H2,(H,29,32)(H,30,31)/t24-/m0/s1 |
InChiKey: | InChIKey=OVAMXXKKOQZOMO-DEOSSOPVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.