* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FMOC-D-ALA(3-PYRROLIDINYL-(2-N-BOC)) |
English Synonyms: | FMOC-D-ALA(3-PYRROLIDINYL-(2-N-BOC)) |
MDL Number.: | MFCD03094822 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | CC(C)(C)OC(=O)N1CCC[C@H]1C[C@H](C(=O)O)NC(=O)OCC2c3ccccc3-c4c2cccc4 |
InChi: | InChI=1S/C27H32N2O6/c1-27(2,3)35-26(33)29-14-8-9-17(29)15-23(24(30)31)28-25(32)34-16-22-20-12-6-4-10-18(20)19-11-5-7-13-21(19)22/h4-7,10-13,17,22-23H,8-9,14-16H2,1-3H3,(H,28,32)(H,30,31)/t17-,23+/m0/s1 |
InChiKey: | InChIKey=IHZFLORRBDPBPS-GAJHUEQPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.