* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ETHYL N-Z-OXAMIDATE |
| CAS: | 236101-09-0 |
| English Synonyms: | ETHYL N-Z-OXAMIDATE |
| MDL Number.: | MFCD03095500 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)C(=O)NC(=O)OCc1ccccc1 |
| InChi: | InChI=1S/C12H13NO5/c1-2-17-11(15)10(14)13-12(16)18-8-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,13,14,16) |
| InChiKey: | InChIKey=JREYAXFCOGQLSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.