* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-(1,3-DIOXOLAN-2-YL)BENZALDEHYDE |
| CAS: | 40681-88-7 |
| English Synonyms: | 4-(1,3-DIOXOLAN-2-YL)BENZALDEHYDE |
| MDL Number.: | MFCD03180272 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1C=O)C2OCCO2 |
| InChi: | InChI=1S/C10H10O3/c11-7-8-1-3-9(4-2-8)10-12-5-6-13-10/h1-4,7,10H,5-6H2 |
| InChiKey: | InChIKey=XXTKORQHKOYXIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.