* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB036503 |
| English Synonyms: | VITAS-BB TBB036503 |
| MDL Number.: | MFCD03312435 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | COC1=CC(=CC(OC)=C1OC)C1C(C(=O)OCCOC2=CC=CC=C2)=C(C)NC2=C1C(=O)CC(C2)C1=CC=CS1 |
| InChi: | InChI=1S/C32H33NO7S/c1-19-28(32(35)40-13-12-39-22-9-6-5-7-10-22)29(21-17-25(36-2)31(38-4)26(18-21)37-3)30-23(33-19)15-20(16-24(30)34)27-11-8-14-41-27/h5-11,14,17-18,20,29,33H,12-13,15-16H2,1-4H3 |
| InChiKey: | InChIKey=KLXIKAZLDSSTPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.