* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034404 |
| English Synonyms: | SYNTHON-LAB SL034404 |
| MDL Number.: | MFCD03834750 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1cc(n(c1)c2ccc(cc2)Cl)/C=C(\C#N)/C(=O)NC3CCCCC3 |
| InChi: | InChI=1S/C20H20ClN3O/c21-16-8-10-18(11-9-16)24-12-4-7-19(24)13-15(14-22)20(25)23-17-5-2-1-3-6-17/h4,7-13,17H,1-3,5-6H2,(H,23,25)/b15-13+ |
| InChiKey: | InChIKey=NBWBUAOWPOCICA-FYWRMAATSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.