* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035593 |
| English Synonyms: | SYNTHON-LAB SL035593 |
| MDL Number.: | MFCD03834859 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | c1cc(cc(c1)C(=O)O)COc2ccc(cc2)/C=C(\C#N)/C(=O)NCC3CCCO3 |
| InChi: | InChI=1S/C23H22N2O5/c24-13-19(22(26)25-14-21-5-2-10-29-21)11-16-6-8-20(9-7-16)30-15-17-3-1-4-18(12-17)23(27)28/h1,3-4,6-9,11-12,21H,2,5,10,14-15H2,(H,25,26)(H,27,28)/b19-11+ |
| InChiKey: | InChIKey=PZMQJUCNHYYCIV-YBFXNURJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.