* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL035610 |
English Synonyms: | SYNTHON-LAB SL035610 |
MDL Number.: | MFCD03834862 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CCC(C)Oc1c(cc(cc1Cl)/C=C(\C#N)/C(=O)NCC2CCCO2)OCC |
InChi: | InChI=1S/C21H27ClN2O4/c1-4-14(3)28-20-18(22)10-15(11-19(20)26-5-2)9-16(12-23)21(25)24-13-17-7-6-8-27-17/h9-11,14,17H,4-8,13H2,1-3H3,(H,24,25)/b16-9+ |
InChiKey: | InChIKey=DGYAFTVUKXTDPG-CXUHLZMHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.