* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL036221 |
| English Synonyms: | SYNTHON-LAB SL036221 |
| MDL Number.: | MFCD03849006 |
| H bond acceptor: | 10 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)N2CCN(CC2)C(=O)CN3C(=O)/C(=C\c4ccc(o4)c5ccccc5[N+](=O)[O-])/SC3=O |
| InChi: | InChI=1S/C26H22N4O6S/c31-24(28-14-12-27(13-15-28)18-6-2-1-3-7-18)17-29-25(32)23(37-26(29)33)16-19-10-11-22(36-19)20-8-4-5-9-21(20)30(34)35/h1-11,16H,12-15,17H2/b23-16+ |
| InChiKey: | InChIKey=UIZPFOSWIWSNFU-XQNSMLJCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.