* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL086190 |
| English Synonyms: | SYNTHON-LAB SL086190 |
| MDL Number.: | MFCD03996644 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCn1c(nnc1SCC(=O)Nc2ccccc2C(C)C)C(C)NC(=O)c3ccccc3 |
| InChi: | InChI=1S/C24H29N5O2S/c1-5-29-22(17(4)25-23(31)18-11-7-6-8-12-18)27-28-24(29)32-15-21(30)26-20-14-10-9-13-19(20)16(2)3/h6-14,16-17H,5,15H2,1-4H3,(H,25,31)(H,26,30) |
| InChiKey: | InChIKey=HLGKDCHUQDDMCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.