* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL053183 |
| English Synonyms: | SYNTHON-LAB SL053183 |
| MDL Number.: | MFCD04024368 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(C)(C)c1ccc(cc1)/C=N/NC(=O)C(=O)NCCCN2CCOCC2 |
| InChi: | InChI=1S/C20H30N4O3/c1-20(2,3)17-7-5-16(6-8-17)15-22-23-19(26)18(25)21-9-4-10-24-11-13-27-14-12-24/h5-8,15H,4,9-14H2,1-3H3,(H,21,25)(H,23,26)/b22-15+ |
| InChiKey: | InChIKey=MUIGKLCSKMYEHN-PXLXIMEGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.