* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL032155 |
| English Synonyms: | SYNTHON-LAB SL032155 |
| MDL Number.: | MFCD04030952 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1cc(c(n1c2ccccn2)C)/C=C/3\C(=O)NC(=S)N(C3=O)CC=C |
| InChi: | InChI=1S/C19H18N4O2S/c1-4-9-22-18(25)15(17(24)21-19(22)26)11-14-10-12(2)23(13(14)3)16-7-5-6-8-20-16/h4-8,10-11H,1,9H2,2-3H3,(H,21,24,26)/b15-11+ |
| InChiKey: | InChIKey=NBBBIOCUQRTYNO-RVDMUPIBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.