* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL086418 |
| English Synonyms: | SYNTHON-LAB SL086418 |
| MDL Number.: | MFCD04086127 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | c1cc(ccc1CCCC(=O)N/N=C/c2ccc3c(c2)OCO3)O |
| InChi: | InChI=1S/C18H18N2O4/c21-15-7-4-13(5-8-15)2-1-3-18(22)20-19-11-14-6-9-16-17(10-14)24-12-23-16/h4-11,21H,1-3,12H2,(H,20,22)/b19-11+ |
| InChiKey: | InChIKey=VZYHYARAIXQEOU-YBFXNURJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.