* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | DIBENZO[B,F]THIEPIN-10(11H)-ONE |
CAS: | 1898-85-7 |
English Synonyms: | DIBENZO[B,F]THIEPIN-10(11H)-ONE |
MDL Number.: | MFCD04108057 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc2c(c1)CC(=O)c3ccccc3S2 |
InChi: | InChI=1S/C14H10OS/c15-12-9-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8H,9H2 |
InChiKey: | InChIKey=IEIUIKHMVGQHBH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.