* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025604 |
| English Synonyms: | VITAS-BB TBB025604 |
| MDL Number.: | MFCD04226631 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | CC1CCC2=C(C1)SC=C2C(=O)NC1CCCC2=C1C=CC=C2 |
| InChi: | InChI=1S/C20H23NOS/c1-13-9-10-16-17(12-23-19(16)11-13)20(22)21-18-8-4-6-14-5-2-3-7-15(14)18/h2-3,5,7,12-13,18H,4,6,8-11H2,1H3,(H,21,22) |
| InChiKey: | InChIKey=WJGVSNBXPNQRGK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.