* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025644 |
| English Synonyms: | VITAS-BB TBB025644 |
| MDL Number.: | MFCD04226639 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [H]C12CC3([H])CC([H])(C1)CC(C2)(C3)N1C=CC(NC(=O)C2=C3C=CC=CC3=NC(=C2)C2=CC3=C(OCO3)C=C2)=N1 |
| InChi: | InChI=1S/C30H28N4O3/c35-29(32-28-7-8-34(33-28)30-14-18-9-19(15-30)11-20(10-18)16-30)23-13-25(31-24-4-2-1-3-22(23)24)21-5-6-26-27(12-21)37-17-36-26/h1-8,12-13,18-20H,9-11,14-17H2,(H,32,33,35) |
| InChiKey: | InChIKey=ZJLAZOOJOSNHRX-JNXBURMTSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.