* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL068909 |
| English Synonyms: | SYNTHON-LAB SL068909 |
| MDL Number.: | MFCD04231084 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | Cc1c(nc(nn1)SCC(=O)OC)O |
| InChi: | InChI=1S/C7H9N3O3S/c1-4-6(12)8-7(10-9-4)14-3-5(11)13-2/h3H2,1-2H3,(H,8,10,12) |
| InChiKey: | InChIKey=OXYFBSBUJKLAPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.