* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL030492 |
| English Synonyms: | SYNTHON-LAB SL030492 |
| MDL Number.: | MFCD04480357 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)COc1c(cc(cc1Br)/C=C\2/C(=O)NC(=O)N2)Br |
| InChi: | InChI=1S/C14H12Br2N2O5/c1-2-22-11(19)6-23-12-8(15)3-7(4-9(12)16)5-10-13(20)18-14(21)17-10/h3-5H,2,6H2,1H3,(H2,17,18,20,21)/b10-5- |
| InChiKey: | InChIKey=DJGQGHSXCXOVOZ-YHYXMXQVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.