* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034231 |
| English Synonyms: | SYNTHON-LAB SL034231 |
| MDL Number.: | MFCD04500488 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCOc1cccc(c1)NC(=O)/C(=C/c2cc(n(c2C)c3ccc(cc3)N4CCOCC4)C)/C#N |
| InChi: | InChI=1S/C28H30N4O3/c1-4-35-27-7-5-6-24(18-27)30-28(33)23(19-29)17-22-16-20(2)32(21(22)3)26-10-8-25(9-11-26)31-12-14-34-15-13-31/h5-11,16-18H,4,12-15H2,1-3H3,(H,30,33)/b23-17+ |
| InChiKey: | InChIKey=ZILJLDOYZXVUAK-HAVVHWLPSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.