* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034707 |
| English Synonyms: | SYNTHON-LAB SL034707 |
| MDL Number.: | MFCD04506533 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | COc1cc(cc(c1OCC#C)Br)/C=N/NC(=O)COc2cccc3c2nccc3 |
| InChi: | InChI=1S/C22H18BrN3O4/c1-3-10-29-22-17(23)11-15(12-19(22)28-2)13-25-26-20(27)14-30-18-8-4-6-16-7-5-9-24-21(16)18/h1,4-9,11-13H,10,14H2,2H3,(H,26,27)/b25-13+ |
| InChiKey: | InChIKey=MJTKHWOIJWXCQI-DHRITJCHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.