* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL034099 |
| English Synonyms: | SYNTHON-LAB SL034099 |
| MDL Number.: | MFCD04531365 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1/N=C\2/NC(=O)/C(=C\c3ccc(c(c3)OC)OC(C)C(=O)O)/S2)Cl |
| InChi: | InChI=1S/C21H19ClN2O5S/c1-11-4-6-14(22)10-15(11)23-21-24-19(25)18(30-21)9-13-5-7-16(17(8-13)28-3)29-12(2)20(26)27/h4-10,12H,1-3H3,(H,26,27)(H,23,24,25)/b18-9+ |
| InChiKey: | InChIKey=HTROECLAAXEVIF-GIJQJNRQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.