* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL030895 |
| English Synonyms: | SYNTHON-LAB SL030895 |
| MDL Number.: | MFCD04552010 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CCOc1cc(cc(c1OCc2ccccc2F)Br)/C=C\3/C(=O)N(C(=O)S3)CC#C |
| InChi: | InChI=1S/C22H17BrFNO4S/c1-3-9-25-21(26)19(30-22(25)27)12-14-10-16(23)20(18(11-14)28-4-2)29-13-15-7-5-6-8-17(15)24/h1,5-8,10-12H,4,9,13H2,2H3/b19-12- |
| InChiKey: | InChIKey=PEDGFKAAZMIEKQ-UNOMPAQXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.