* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | SYNTHON-LAB SL033126 |
English Synonyms: | SYNTHON-LAB SL033126 |
MDL Number.: | MFCD04553070 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1/C=C/2\C(=O)N(C(=O)N2)Cc3ccc(cc3Cl)Cl)F)N4CCCC4 |
InChi: | InChI=1S/C21H18Cl2FN3O2/c22-15-5-4-14(16(23)11-15)12-27-20(28)18(25-21(27)29)10-13-3-6-19(17(24)9-13)26-7-1-2-8-26/h3-6,9-11H,1-2,7-8,12H2,(H,25,29)/b18-10+ |
InChiKey: | InChIKey=LHJGEHIUJBWGAJ-VCHYOVAHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.