* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL031287 |
| English Synonyms: | SYNTHON-LAB SL031287 |
| MDL Number.: | MFCD04570369 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3ccc(c(c3)OC)OCC(=O)Nc4ccc(cc4)F)/SC2=O |
| InChi: | InChI=1S/C28H24FN3O6S/c1-17-3-8-20(9-4-17)30-25(33)15-32-27(35)24(39-28(32)36)14-18-5-12-22(23(13-18)37-2)38-16-26(34)31-21-10-6-19(29)7-11-21/h3-14H,15-16H2,1-2H3,(H,30,33)(H,31,34)/b24-14+ |
| InChiKey: | InChIKey=QMMGQPJEIIHBGP-ZVHZXABRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.