* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL083069 |
| English Synonyms: | SYNTHON-LAB SL083069 |
| MDL Number.: | MFCD04576520 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC1(OCCO1)CC(=O)N/N=C/c2cc(cs2)[N+](=O)[O-] |
| InChi: | InChI=1S/C11H13N3O5S/c1-11(18-2-3-19-11)5-10(15)13-12-6-9-4-8(7-20-9)14(16)17/h4,6-7H,2-3,5H2,1H3,(H,13,15)/b12-6+ |
| InChiKey: | InChIKey=HFTBNIKSLFPAKD-WUXMJOGZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.