* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL092487 |
| English Synonyms: | SYNTHON-LAB SL092487 |
| MDL Number.: | MFCD04576677 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | CC1CCCN(C1)C2=NC(=O)/C(=C/c3ccc4c(c3)OCO4)/S2 |
| InChi: | InChI=1S/C17H18N2O3S/c1-11-3-2-6-19(9-11)17-18-16(20)15(23-17)8-12-4-5-13-14(7-12)22-10-21-13/h4-5,7-8,11H,2-3,6,9-10H2,1H3/b15-8- |
| InChiKey: | InChIKey=ZJCPGYMEEDXTFE-NVNXTCNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.