* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL049751 |
| English Synonyms: | SYNTHON-LAB SL049751 |
| MDL Number.: | MFCD04599710 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(cc1)NC(=O)COc2cccc(c2)/C=N/NC(=O)C(=O)Nc3ccccc3C |
| InChi: | InChI=1S/C25H24N4O4/c1-17-10-12-20(13-11-17)27-23(30)16-33-21-8-5-7-19(14-21)15-26-29-25(32)24(31)28-22-9-4-3-6-18(22)2/h3-15H,16H2,1-2H3,(H,27,30)(H,28,31)(H,29,32)/b26-15+ |
| InChiKey: | InChIKey=YOGSRVJKMCQLPW-CVKSISIWSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.