* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL035143 |
| English Synonyms: | SYNTHON-LAB SL035143 |
| MDL Number.: | MFCD04601432 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(cc1)NC(=O)CN2C(=O)/C(=C\c3cc(c(c(c3)Br)O)Cl)/NC2=O |
| InChi: | InChI=1S/C19H15BrClN3O4/c1-10-2-4-12(5-3-10)22-16(25)9-24-18(27)15(23-19(24)28)8-11-6-13(20)17(26)14(21)7-11/h2-8,26H,9H2,1H3,(H,22,25)(H,23,28)/b15-8+ |
| InChiKey: | InChIKey=LYJGXUFSTZPVLK-OVCLIPMQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.