* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product_Name: | (R)-(-)-2-HEXYL ISOCYANATE |
| CAS: | 745783-77-1 |
| EnglishSynonyms: | (2R)-2-ISOCYANATOHEXANE ; (R)-(-)-2-HEXYL ISOCYANATE |
| pro_mdlNumber: | MFCD05664079 |
| pro_acceptors: | 2 |
| pro_donors: | 0 |
| pro_smile: | CCCC[C@@H](C)N=C=O |
| InChi: | InChI=1S/C7H13NO/c1-3-4-5-7(2)8-6-9/h7H,3-5H2,1-2H3/t7-/m1/s1 |
| InChiKey: | InChIKey=JNWLFMYCGXLVJQ-SSDOTTSWSA-N |
|
|
| PhysicalProperty: | REFRACTIVE INDEX: 1.4180 |
| Comments: | BRN: 8253639 EINECS: 000-000-0 HAZARD: R 10-22-23-36/37/38-42 HAZARD: S 23-26-36/37-45 SENSITIVITY: MOISTURE SENSITIVE TOXIC UN NUMBER: UN3080 |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.