* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BE 1041 |
English Synonyms: | RARECHEM AL BE 1041 |
MDL Number.: | MFCD06203409 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC(=O)Cc1c(c([nH]c1Cl)C(=O)O)C(=O)OC |
InChi: | InChI=1S/C10H10ClNO6/c1-17-5(13)3-4-6(10(16)18-2)7(9(14)15)12-8(4)11/h12H,3H2,1-2H3,(H,14,15) |
InChiKey: | InChIKey=VDJHEPRJDFMVCU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.