* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BF 1258 |
English Synonyms: | RARECHEM AL BF 1258 |
MDL Number.: | MFCD06204136 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | COC(=O)C(c1ccccc1)C(C(F)(F)F)Cl |
InChi: | InChI=1S/C11H10ClF3O2/c1-17-10(16)8(9(12)11(13,14)15)7-5-3-2-4-6-7/h2-6,8-9H,1H3 |
InChiKey: | InChIKey=LXNNHVIDJKOCPU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.