* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BL 0801 |
| English Synonyms: | RARECHEM AL BL 0801 |
| MDL Number.: | MFCD06206372 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | CC(C)(C)c1cccc(c1O)C(CC(=O)O)N |
| InChi: | InChI=1S/C13H19NO3/c1-13(2,3)9-6-4-5-8(12(9)17)10(14)7-11(15)16/h4-6,10,17H,7,14H2,1-3H3,(H,15,16) |
| InChiKey: | InChIKey=QWGQVKGHPLSQAI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.