* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1437 |
English Synonyms: | RARECHEM AL BO 1437 |
MDL Number.: | MFCD06208411 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C(CCC[Zn]Br)CCC(=O)O |
InChi: | InChI=1S/C7H13O2.BrH.Zn/c1-2-3-4-5-6-7(8)9;;/h1-6H2,(H,8,9);1H;/q;;+1/p-1 |
InChiKey: | InChIKey=AFYBDRDSDQRBMU-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.