* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BO 1820 |
English Synonyms: | RARECHEM AL BO 1820 |
MDL Number.: | MFCD06208600 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)/C=N/C(=C(\C(=O)O)/NCc2c(nc(s2)Cl)Cl)/C(=O)O |
InChi: | InChI=1S/C15H11Cl2N3O4S/c16-12-9(25-15(17)20-12)7-19-11(14(23)24)10(13(21)22)18-6-8-4-2-1-3-5-8/h1-6,19H,7H2,(H,21,22)(H,23,24)/b11-10+,18-6+ |
InChiKey: | InChIKey=CJAZYEPGKDLUQA-UFGYZORQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.