* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BP 1121 |
English Synonyms: | RARECHEM AL BP 1121 |
MDL Number.: | MFCD06209838 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | c1cc(c(c(c1)C(=O)O)[N+](=O)[O-])/C(=C/O)/C2OCCO2 |
InChi: | InChI=1S/C12H11NO7/c14-6-9(12-19-4-5-20-12)7-2-1-3-8(11(15)16)10(7)13(17)18/h1-3,6,12,14H,4-5H2,(H,15,16)/b9-6- |
InChiKey: | InChIKey=YCVLDFYBOYFJTF-TWGQIWQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.