* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | RARECHEM AL BP 1280 |
English Synonyms: | RARECHEM AL BP 1280 |
MDL Number.: | MFCD06209984 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)c(c([nH]2)c3cccc(c3)Cl)C4OCCO4 |
InChi: | InChI=1S/C17H14ClNO2/c18-12-5-3-4-11(10-12)16-15(17-20-8-9-21-17)13-6-1-2-7-14(13)19-16/h1-7,10,17,19H,8-9H2 |
InChiKey: | InChIKey=FGTKXRRNANADOO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.