* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | RARECHEM AL BP 1282 |
English Synonyms: | RARECHEM AL BP 1282 |
MDL Number.: | MFCD06209986 |
H bond acceptor: | 6 |
H bond donor: | 0 |
Smile: | Cc1ccc(cc1)S(=O)(=O)Oc2ccc(cc2OC)C3OCCO3 |
InChi: | InChI=1S/C17H18O6S/c1-12-3-6-14(7-4-12)24(18,19)23-15-8-5-13(11-16(15)20-2)17-21-9-10-22-17/h3-8,11,17H,9-10H2,1-2H3 |
InChiKey: | InChIKey=UXAYCVVFIINPEF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.