* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0291 |
English Synonyms: | RARECHEM AL BT 0291 |
MDL Number.: | MFCD06211956 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | c1cc(c(c(c1F)C(CCO)N)Cl)F.Cl |
InChi: | InChI=1S/C9H10ClF2NO.ClH/c10-9-6(12)2-1-5(11)8(9)7(13)3-4-14;/h1-2,7,14H,3-4,13H2;1H |
InChiKey: | InChIKey=JOWHRVZPDQAZGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.