* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0456 |
English Synonyms: | RARECHEM AL BT 0456 |
MDL Number.: | MFCD06212113 |
H bond acceptor: | 2 |
H bond donor: | 2 |
Smile: | Cc1ccc(c(c1)Br)C(CCO)N.Cl |
InChi: | InChI=1S/C10H14BrNO.ClH/c1-7-2-3-8(9(11)6-7)10(12)4-5-13;/h2-3,6,10,13H,4-5,12H2,1H3;1H |
InChiKey: | InChIKey=LBNFUUPENNLJSS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.