* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BT 0484 |
English Synonyms: | RARECHEM AL BT 0484 |
MDL Number.: | MFCD06212139 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)Sc2ccc(cc2[N+](=O)[O-])C(CCO)N.Cl |
InChi: | InChI=1S/C16H18N2O3S.ClH/c1-11-2-5-13(6-3-11)22-16-7-4-12(14(17)8-9-19)10-15(16)18(20)21;/h2-7,10,14,19H,8-9,17H2,1H3;1H |
InChiKey: | InChIKey=GVUYUPBMKWIKPP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.