* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BW 1677 |
English Synonyms: | RARECHEM AL BW 1677 |
MDL Number.: | MFCD06213424 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | c1cc(ccc1CN)C[N+]2(CCCCC2)Cc3nc(no3)c4ccc(cc4)Cl.[Br-] |
InChi: | InChI=1S/C22H26ClN4O.BrH/c23-20-10-8-19(9-11-20)22-25-21(28-26-22)16-27(12-2-1-3-13-27)15-18-6-4-17(14-24)5-7-18;/h4-11H,1-3,12-16,24H2;1H/q+1;/p-1 |
InChiKey: | InChIKey=ZIAKFVFMYKRMCH-UHFFFAOYSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.